C17H21N3O2 — CID 96565943
1-methyl-N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 96565943) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-methyl-N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 96565943 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-methyl-N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc([C@@H]2OCCC[C@@H]2NC(=O)c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-5-7-13(8-6-12)16-15(4-3-9-22-16)19-17(21)14-10-18-20(2)11-14/h5-8,10-11,15-16H,3-4,9H2,1-2H3,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | LKTMKQVCYDRYGQ-HOTGVXAUSA-N |
| XLogP | 2.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |