C17H27ClN2O2 — CID 119818126
2-methyl-3-(methylamino)-N-[2-(4-methylphenyl)oxan-3-yl]propanamide;hydrochloride (PubChem CID 119818126) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[2-(4-methylphenyl)oxan-3-yl]propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-[2-(4-methylphenyl)oxan-3-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119818126 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[2-(4-methylphenyl)oxan-3-yl]propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NC1CCCOC1c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C17H26N2O2.ClH/c1-12-6-8-14(9-7-12)16-15(5-4-10-21-16)19-17(20)13(2)11-18-3;/h6-9,13,15-16,18H,4-5,10-11H2,1-3H3,(H,19,20);1H |
| InChIKey | GKVGDBOXVXXVSA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |