C18H25NO3 — CID 95964708
N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]oxane-4-carboxamide (PubChem CID 95964708) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]oxane-4-carboxamide.
| Compound Name | N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 95964708 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[(2S,3S)-2-(4-methylphenyl)oxan-3-yl]oxane-4-carboxamide |
| SMILES | Cc1ccc([C@@H]2OCCC[C@@H]2NC(=O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-13-4-6-14(7-5-13)17-16(3-2-10-22-17)19-18(20)15-8-11-21-12-9-15/h4-7,15-17H,2-3,8-12H2,1H3,(H,19,20)/t16-,17-/m0/s1 |
| InChIKey | XHQKTTMZQMAGOS-IRXDYDNUSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |