C18H25N3O — CID 129370432
(2R,3S)-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylphenyl)oxan-3-amine (PubChem CID 129370432) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (2R,3S)-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylphenyl)oxan-3-amine.
| Compound Name | (2R,3S)-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylphenyl)oxan-3-amine |
|---|---|
| PubChem CID | 129370432 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2R,3S)-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylphenyl)oxan-3-amine |
| SMILES | CCn1cc(CN[C@H]2CCCO[C@@H]2c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C18H25N3O/c1-3-21-13-15(12-20-21)11-19-17-5-4-10-22-18(17)16-8-6-14(2)7-9-16/h6-9,12-13,17-19H,3-5,10-11H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | TYVFBOLKDXOCLJ-ZWKOTPCHSA-N |
| XLogP | 3.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |