C18H22N2O — CID 124508072
(2R,3S)-2-(4-methylphenyl)-N-(pyridin-4-ylmethyl)oxan-3-amine (PubChem CID 124508072) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R,3S)-2-(4-methylphenyl)-N-(pyridin-4-ylmethyl)oxan-3-amine.
| Compound Name | (2R,3S)-2-(4-methylphenyl)-N-(pyridin-4-ylmethyl)oxan-3-amine |
|---|---|
| PubChem CID | 124508072 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2R,3S)-2-(4-methylphenyl)-N-(pyridin-4-ylmethyl)oxan-3-amine |
| SMILES | Cc1ccc([C@H]2OCCC[C@@H]2NCc2ccncc2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-14-4-6-16(7-5-14)18-17(3-2-12-21-18)20-13-15-8-10-19-11-9-15/h4-11,17-18,20H,2-3,12-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | YPXSQHUOJXMENA-ZWKOTPCHSA-N |
| XLogP | 3.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |