C19H20N2O2 — CID 131958474
(2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-pyridin-4-yloxan-3-amine (PubChem CID 131958474) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-pyridin-4-yloxan-3-amine.
| Compound Name | (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-pyridin-4-yloxan-3-amine |
|---|---|
| PubChem CID | 131958474 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2R,3S)-N-(1-benzofuran-3-ylmethyl)-2-pyridin-4-yloxan-3-amine |
| SMILES | c1ccc2c(CN[C@H]3CCCO[C@@H]3c3ccncc3)coc2c1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-6-18-16(4-1)15(13-23-18)12-21-17-5-3-11-22-19(17)14-7-9-20-10-8-14/h1-2,4,6-10,13,17,19,21H,3,5,11-12H2/t17-,19+/m0/s1 |
| InChIKey | YRBAONFTBIFRJQ-PKOBYXMFSA-N |
| XLogP | 3.84 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |