C22H29N3O — CID 129488964
(3S)-1-benzyl-N-[(2R,3S)-2-pyridin-4-yloxan-3-yl]piperidin-3-amine (PubChem CID 129488964) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (3S)-1-benzyl-N-[(2R,3S)-2-pyridin-4-yloxan-3-yl]piperidin-3-amine.
| Compound Name | (3S)-1-benzyl-N-[(2R,3S)-2-pyridin-4-yloxan-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 129488964 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (3S)-1-benzyl-N-[(2R,3S)-2-pyridin-4-yloxan-3-yl]piperidin-3-amine |
| SMILES | c1ccc(CN2CCC[C@H](N[C@H]3CCCO[C@@H]3c3ccncc3)C2)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-2-6-18(7-3-1)16-25-14-4-8-20(17-25)24-21-9-5-15-26-22(21)19-10-12-23-13-11-19/h1-3,6-7,10-13,20-22,24H,4-5,8-9,14-17H2/t20-,21-,22+/m0/s1 |
| InChIKey | ABKVPUQUVMSECS-FDFHNCONSA-N |
| XLogP | 3.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |