C22H32N4O — CID 128998209
1-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]piperidin-3-amine (PubChem CID 128998209) has the molecular formula C22H32N4O and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]piperidin-3-amine.
| Compound Name | 1-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 128998209 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]piperidin-3-amine |
| SMILES | CCn1ccnc1[C@H]1OCCC[C@@H]1NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N4O/c1-2-26-14-12-23-22(26)21-20(11-7-15-27-21)24-19-10-6-13-25(17-19)16-18-8-4-3-5-9-18/h3-5,8-9,12,14,19-21,24H,2,6-7,10-11,13,15-17H2,1H3/t19?,20-,21-/m0/s1 |
| InChIKey | IJDKIOFNEXHNPV-AKQSQHNNSA-N |
| XLogP | 3.38 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |