C21H30N4O — CID 128996135
1-benzyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]piperidin-3-amine (PubChem CID 128996135) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-benzyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]piperidin-3-amine.
| Compound Name | 1-benzyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 128996135 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-benzyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]piperidin-3-amine |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2NC2CCCN(Cc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C21H30N4O/c1-24-15-18(13-22-24)21-20(10-6-12-26-21)23-19-9-5-11-25(16-19)14-17-7-3-2-4-8-17/h2-4,7-8,13,15,19-21,23H,5-6,9-12,14,16H2,1H3/t19?,20-,21+/m0/s1 |
| InChIKey | CUWIRZBVVWWXCV-GJGLBJJNSA-N |
| XLogP | 2.89 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |