C23H32N4O2 — CID 97279082
2-[(2R)-4-benzylmorpholin-2-yl]-1-[4-(1-ethylimidazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 97279082) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[(2R)-4-benzylmorpholin-2-yl]-1-[4-(1-ethylimidazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-[(2R)-4-benzylmorpholin-2-yl]-1-[4-(1-ethylimidazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97279082 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[(2R)-4-benzylmorpholin-2-yl]-1-[4-(1-ethylimidazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | CCn1ccnc1C1CCN(C(=O)C[C@@H]2CN(Cc3ccccc3)CCO2)CC1 |
| InChI | InChI=1S/C23H32N4O2/c1-2-26-13-10-24-23(26)20-8-11-27(12-9-20)22(28)16-21-18-25(14-15-29-21)17-19-6-4-3-5-7-19/h3-7,10,13,20-21H,2,8-9,11-12,14-18H2,1H3/t21-/m1/s1 |
| InChIKey | NZIRAEYOOSWPOG-OAQYLSRUSA-N |
| XLogP | 2.90 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |