About 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine
2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine (PubChem CID 128993386) has the molecular formula C21H25N5O
and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine |
| PubChem CID | 128993386 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine |
| SMILES | CCn1ccnc1[C@H]1OCCC[C@@H]1Nc1ccnc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H25N5O/c1-2-26-13-12-23-21(26)20-17(9-6-14-27-20)24-18-10-11-22-19(25-18)15-16-7-4-3-5-8-16/h3-5,7-8,10-13,17,20H,2,6,9,14-15H2,1H3,(H,22,24,25)/t17-,20-/m0/s1 |
| InChIKey | OFXYRPRIAYXLRL-PXNSSMCTSA-N |
| XLogP | 3.62 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The IUPAC name of 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine (CID 128993386) is 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine.
What is the SMILES notation for 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The canonical SMILES for 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine is CCn1ccnc1[C@H]1OCCC[C@@H]1Nc1ccnc(Cc2ccccc2)n1.
What is the InChIKey of 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The InChIKey is OFXYRPRIAYXLRL-PXNSSMCTSA-N. The full InChI is InChI=1S/C21H25N5O/c1-2-26-13-12-23-21(26)20-17(9-6-14-27-20)24-18-10-11-22-19(25-18)15-16-7-4-3-5-8-16/h3-5,7-8,10-13,17,20H,2,6,9,14-15H2,1H3,(H,22,24,25)/t17-,20-/m0/s1.
What are the key properties of 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine has a molecular weight of 363.47 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 128993386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).