C20H29N3O — CID 129400645
(2S,3S)-2-(1-ethylimidazol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]oxan-3-amine (PubChem CID 129400645) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is (2S,3S)-2-(1-ethylimidazol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]oxan-3-amine.
| Compound Name | (2S,3S)-2-(1-ethylimidazol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]oxan-3-amine |
|---|---|
| PubChem CID | 129400645 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | (2S,3S)-2-(1-ethylimidazol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]oxan-3-amine |
| SMILES | CCn1ccnc1[C@H]1OCCC[C@@H]1N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O/c1-3-23-14-13-21-20(23)19-18(10-7-15-24-19)22-16(2)11-12-17-8-5-4-6-9-17/h4-6,8-9,13-14,16,18-19,22H,3,7,10-12,15H2,1-2H3/t16-,18-,19-/m0/s1 |
| InChIKey | DUSIGRRZMWAVGI-WDSOQIARSA-N |
| XLogP | 3.73 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |