C13H17N5O3 — CID 128968666
1-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]-3-(1,2-oxazol-3-yl)urea (PubChem CID 128968666) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 128968666 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]-3-(1,2-oxazol-3-yl)urea |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2NC(=O)Nc2ccon2)cn1 |
| InChI | InChI=1S/C13H17N5O3/c1-18-8-9(7-14-18)12-10(3-2-5-20-12)15-13(19)16-11-4-6-21-17-11/h4,6-8,10,12H,2-3,5H2,1H3,(H2,15,16,17,19)/t10-,12+/m0/s1 |
| InChIKey | NCAHFMSCEGNIQH-CMPLNLGQSA-N |
| XLogP | 1.45 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |