C16H20FN5O2 — CID 128993229
1-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-3-(3-fluoro-4-pyridinyl)urea (PubChem CID 128993229) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is 1-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-3-(3-fluoro-4-pyridinyl)urea.
| Compound Name | 1-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-3-(3-fluoro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 128993229 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-3-(3-fluoro-4-pyridinyl)urea |
| SMILES | CCn1cc([C@H]2OCCC[C@@H]2NC(=O)Nc2ccncc2F)cn1 |
| InChI | InChI=1S/C16H20FN5O2/c1-2-22-10-11(8-19-22)15-14(4-3-7-24-15)21-16(23)20-13-5-6-18-9-12(13)17/h5-6,8-10,14-15H,2-4,7H2,1H3,(H2,18,20,21,23)/t14-,15+/m0/s1 |
| InChIKey | XNNZAGRTFPQBMD-LSDHHAIUSA-N |
| XLogP | 2.48 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |