C18H30N4O2 — CID 128981450
N-[4-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]cyclohexyl]acetamide (PubChem CID 128981450) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[4-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 128981450 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-[4-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]cyclohexyl]acetamide |
| SMILES | CCn1cc([C@H]2OCCC[C@@H]2NC2CCC(NC(C)=O)CC2)cn1 |
| InChI | InChI=1S/C18H30N4O2/c1-3-22-12-14(11-19-22)18-17(5-4-10-24-18)21-16-8-6-15(7-9-16)20-13(2)23/h11-12,15-18,21H,3-10H2,1-2H3,(H,20,23)/t15?,16?,17-,18+/m0/s1 |
| InChIKey | YNKSGGCUBUJZFU-ZGUYJTEBSA-N |
| XLogP | 2.16 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |