C19H22N4O2 — CID 129006077
N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-1H-indole-7-carboxamide (PubChem CID 129006077) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-1H-indole-7-carboxamide.
| Compound Name | N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 129006077 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-1H-indole-7-carboxamide |
| SMILES | CCn1cc([C@H]2OCCC[C@@H]2NC(=O)c2cccc3cc[nH]c23)cn1 |
| InChI | InChI=1S/C19H22N4O2/c1-2-23-12-14(11-21-23)18-16(7-4-10-25-18)22-19(24)15-6-3-5-13-8-9-20-17(13)15/h3,5-6,8-9,11-12,16,18,20H,2,4,7,10H2,1H3,(H,22,24)/t16-,18+/m0/s1 |
| InChIKey | WOXWITNVFPPTQC-FUHWJXTLSA-N |
| XLogP | 3.03 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |