C18H22FN3O2 — CID 129006150
N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-2-fluoro-3-methylbenzamide (PubChem CID 129006150) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-2-fluoro-3-methylbenzamide.
| Compound Name | N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 129006150 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]-2-fluoro-3-methylbenzamide |
| SMILES | CCn1cc([C@H]2OCCC[C@@H]2NC(=O)c2cccc(C)c2F)cn1 |
| InChI | InChI=1S/C18H22FN3O2/c1-3-22-11-13(10-20-22)17-15(8-5-9-24-17)21-18(23)14-7-4-6-12(2)16(14)19/h4,6-7,10-11,15,17H,3,5,8-9H2,1-2H3,(H,21,23)/t15-,17+/m0/s1 |
| InChIKey | BSSOENNHTUBPJX-DOTOQJQBSA-N |
| XLogP | 3.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |