C17H29N3O3 — CID 136588873
butyl 2-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]propanoate (PubChem CID 136588873) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is butyl 2-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]propanoate.
| Compound Name | butyl 2-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 136588873 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | butyl 2-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxan-3-yl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)N[C@@H]1CCCO[C@H]1c1cnn(CC)c1 |
| InChI | InChI=1S/C17H29N3O3/c1-4-6-9-23-17(21)13(3)19-15-8-7-10-22-16(15)14-11-18-20(5-2)12-14/h11-13,15-16,19H,4-10H2,1-3H3/t13?,15-,16+/m1/s1 |
| InChIKey | RXPVUXVZCPZZCK-CZVYVAOFSA-N |
| XLogP | 2.44 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|