C13H18FN3OS — CID 75506436
1-(2-ethylsulfanylcyclopentyl)-3-(3-fluoro-4-pyridinyl)urea (PubChem CID 75506436) has the molecular formula C13H18FN3OS and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2-ethylsulfanylcyclopentyl)-3-(3-fluoro-4-pyridinyl)urea.
| Compound Name | 1-(2-ethylsulfanylcyclopentyl)-3-(3-fluoro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 75506436 |
| Molecular Formula | C13H18FN3OS |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(2-ethylsulfanylcyclopentyl)-3-(3-fluoro-4-pyridinyl)urea |
| SMILES | CCSC1CCCC1NC(=O)Nc1ccncc1F |
| InChI | InChI=1S/C13H18FN3OS/c1-2-19-12-5-3-4-11(12)17-13(18)16-10-6-7-15-8-9(10)14/h6-8,11-12H,2-5H2,1H3,(H2,15,16,17,18) |
| InChIKey | RCZXWPBPGDESDA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |