C16H25N3OS — CID 98775732
1-[(1R,2R)-2-ethylsulfanylcyclohexyl]-3-[(1R)-1-pyridin-4-ylethyl]urea (PubChem CID 98775732) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 1-[(1R,2R)-2-ethylsulfanylcyclohexyl]-3-[(1R)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-[(1R,2R)-2-ethylsulfanylcyclohexyl]-3-[(1R)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 98775732 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[(1R,2R)-2-ethylsulfanylcyclohexyl]-3-[(1R)-1-pyridin-4-ylethyl]urea |
| SMILES | CCS[C@@H]1CCCC[C@H]1NC(=O)N[C@H](C)c1ccncc1 |
| InChI | InChI=1S/C16H25N3OS/c1-3-21-15-7-5-4-6-14(15)19-16(20)18-12(2)13-8-10-17-11-9-13/h8-12,14-15H,3-7H2,1-2H3,(H2,18,19,20)/t12-,14-,15-/m1/s1 |
| InChIKey | WOARYIGUEIKZLM-BPLDGKMQSA-N |
| XLogP | 3.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |