C14H28N2O2S — CID 111840883
1-(2-ethylsulfanylcyclohexyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea (PubChem CID 111840883) has the molecular formula C14H28N2O2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-(2-ethylsulfanylcyclohexyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea.
| Compound Name | 1-(2-ethylsulfanylcyclohexyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111840883 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-(2-ethylsulfanylcyclohexyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
| SMILES | CCSC1CCCCC1NC(=O)NC(C)C(C)CO |
| InChI | InChI=1S/C14H28N2O2S/c1-4-19-13-8-6-5-7-12(13)16-14(18)15-11(3)10(2)9-17/h10-13,17H,4-9H2,1-3H3,(H2,15,16,18) |
| InChIKey | NCFJKFRDGXAOBR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |