C12H17BrN2S — CID 124679598
3-bromo-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]pyridin-4-amine (PubChem CID 124679598) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 3-bromo-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]pyridin-4-amine.
| Compound Name | 3-bromo-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]pyridin-4-amine |
|---|---|
| PubChem CID | 124679598 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-bromo-N-[(1R,2R)-2-ethylsulfanylcyclopentyl]pyridin-4-amine |
| SMILES | CCS[C@@H]1CCC[C@H]1Nc1ccncc1Br |
| InChI | InChI=1S/C12H17BrN2S/c1-2-16-12-5-3-4-11(12)15-10-6-7-14-8-9(10)13/h6-8,11-12H,2-5H2,1H3,(H,14,15)/t11-,12-/m1/s1 |
| InChIKey | HPEAAZIHQAZVMS-VXGBXAGGSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |