C18H24N4S — CID 133357230
6-ethyl-N-(2-ethylsulfanylcyclopentyl)-2-pyridin-4-ylpyrimidin-4-amine (PubChem CID 133357230) has the molecular formula C18H24N4S and a molecular weight of 328.48 g/mol. Its IUPAC name is 6-ethyl-N-(2-ethylsulfanylcyclopentyl)-2-pyridin-4-ylpyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(2-ethylsulfanylcyclopentyl)-2-pyridin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133357230 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 6-ethyl-N-(2-ethylsulfanylcyclopentyl)-2-pyridin-4-ylpyrimidin-4-amine |
| SMILES | CCSC1CCCC1Nc1cc(CC)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H24N4S/c1-3-14-12-17(21-15-6-5-7-16(15)23-4-2)22-18(20-14)13-8-10-19-11-9-13/h8-12,15-16H,3-7H2,1-2H3,(H,20,21,22) |
| InChIKey | WTCPKSOCYHXLTL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |