C13H17F3N2S — CID 103804882
N-(2-ethylsulfanylcyclopentyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 103804882) has the molecular formula C13H17F3N2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclopentyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-ethylsulfanylcyclopentyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103804882 |
| Molecular Formula | C13H17F3N2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(2-ethylsulfanylcyclopentyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCSC1CCCC1Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H17F3N2S/c1-2-19-11-5-3-4-10(11)18-12-7-6-9(8-17-12)13(14,15)16/h6-8,10-11H,2-5H2,1H3,(H,17,18) |
| InChIKey | BVKFQISYBCDLOF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |