C11H14F3N3O — CID 167479090
4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol (PubChem CID 167479090) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol.
| Compound Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 167479090 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-3-ol |
| SMILES | OC1CNCCC1Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)7-1-2-10(16-5-7)17-8-3-4-15-6-9(8)18/h1-2,5,8-9,15,18H,3-4,6H2,(H,16,17) |
| InChIKey | ARJHJYPERAZJLX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |