C14H19F3N2 — CID 79870374
N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 79870374) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 79870374 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1(C)CCCCC1Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H19F3N2/c1-13(2)8-4-3-5-11(13)19-12-7-6-10(9-18-12)14(15,16)17/h6-7,9,11H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | STFBKICBJAXIRL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |