C11H16BrN3 — CID 114695454
3-bromo-N-(2-methylpiperidin-3-yl)pyridin-4-amine (PubChem CID 114695454) has the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 3-bromo-N-(2-methylpiperidin-3-yl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(2-methylpiperidin-3-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 114695454 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-bromo-N-(2-methylpiperidin-3-yl)pyridin-4-amine |
| SMILES | CC1NCCCC1Nc1ccncc1Br |
| InChI | InChI=1S/C11H16BrN3/c1-8-10(3-2-5-14-8)15-11-4-6-13-7-9(11)12/h4,6-8,10,14H,2-3,5H2,1H3,(H,13,15) |
| InChIKey | GMWVNOSXWXRLIA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |