C12H18BrN3 — CID 104777475
3-bromo-N-(2-piperidin-3-ylethyl)pyridin-4-amine (PubChem CID 104777475) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 3-bromo-N-(2-piperidin-3-ylethyl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(2-piperidin-3-ylethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 104777475 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-bromo-N-(2-piperidin-3-ylethyl)pyridin-4-amine |
| SMILES | Brc1cnccc1NCCC1CCCNC1 |
| InChI | InChI=1S/C12H18BrN3/c13-11-9-15-6-4-12(11)16-7-3-10-2-1-5-14-8-10/h4,6,9-10,14H,1-3,5,7-8H2,(H,15,16) |
| InChIKey | WQXYZPMVKIYBEU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |