C14H21BrN2 — CID 104777079
3-bromo-N-[2-(3-methylcyclohexyl)ethyl]pyridin-4-amine (PubChem CID 104777079) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 3-bromo-N-[2-(3-methylcyclohexyl)ethyl]pyridin-4-amine.
| Compound Name | 3-bromo-N-[2-(3-methylcyclohexyl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 104777079 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-bromo-N-[2-(3-methylcyclohexyl)ethyl]pyridin-4-amine |
| SMILES | CC1CCCC(CCNc2ccncc2Br)C1 |
| InChI | InChI=1S/C14H21BrN2/c1-11-3-2-4-12(9-11)5-8-17-14-6-7-16-10-13(14)15/h6-7,10-12H,2-5,8-9H2,1H3,(H,16,17) |
| InChIKey | YIKNVIQNEWSPCE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |