C14H23N3 — CID 104540431
3-N-[2-(3-methylcyclohexyl)ethyl]pyridine-2,3-diamine (PubChem CID 104540431) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-N-[2-(3-methylcyclohexyl)ethyl]pyridine-2,3-diamine.
| Compound Name | 3-N-[2-(3-methylcyclohexyl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104540431 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3-N-[2-(3-methylcyclohexyl)ethyl]pyridine-2,3-diamine |
| SMILES | CC1CCCC(CCNc2cccnc2N)C1 |
| InChI | InChI=1S/C14H23N3/c1-11-4-2-5-12(10-11)7-9-16-13-6-3-8-17-14(13)15/h3,6,8,11-12,16H,2,4-5,7,9-10H2,1H3,(H2,15,17) |
| InChIKey | RZBXCWTYRNNWCT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |