C10H14Cl2N4 — CID 114695592
3,6-dichloro-N-(2-methylpiperidin-3-yl)pyridazin-4-amine (PubChem CID 114695592) has the molecular formula C10H14Cl2N4 and a molecular weight of 261.16 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-methylpiperidin-3-yl)pyridazin-4-amine.
| Compound Name | 3,6-dichloro-N-(2-methylpiperidin-3-yl)pyridazin-4-amine |
|---|---|
| PubChem CID | 114695592 |
| Molecular Formula | C10H14Cl2N4 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3,6-dichloro-N-(2-methylpiperidin-3-yl)pyridazin-4-amine |
| SMILES | CC1NCCCC1Nc1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C10H14Cl2N4/c1-6-7(3-2-4-13-6)14-8-5-9(11)15-16-10(8)12/h5-7,13H,2-4H2,1H3,(H,14,15) |
| InChIKey | IWDOUAGEGATBTJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |