About 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine
3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine (PubChem CID 130905616) has the molecular formula C10H13Cl2N3
and a molecular weight of 246.14 g/mol. Its IUPAC name is 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine.
Molecular Properties
| Compound Name | 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine |
| PubChem CID | 130905616 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine |
| SMILES | CC1CC(Nc2cc(Cl)nnc2Cl)C1C |
| InChI | InChI=1S/C10H13Cl2N3/c1-5-3-7(6(5)2)13-8-4-9(11)14-15-10(8)12/h4-7H,3H2,1-2H3,(H,13,14) |
| InChIKey | HKPXBHVUDFWUNH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine?
The IUPAC name of 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine (CID 130905616) is 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine.
What is the SMILES notation for 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine?
The canonical SMILES for 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine is CC1CC(Nc2cc(Cl)nnc2Cl)C1C.
What is the InChIKey of 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine?
The InChIKey is HKPXBHVUDFWUNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2N3/c1-5-3-7(6(5)2)13-8-4-9(11)14-15-10(8)12/h4-7H,3H2,1-2H3,(H,13,14).
What are the key properties of 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine?
3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine has a molecular weight of 246.14 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-N-(2,3-dimethylcyclobutyl)pyridazin-4-amine is sourced from PubChem (CID 130905616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).