C11H17NS — CID 130735161
N-(2,3-dimethylcyclobutyl)-4-methylthiophen-3-amine (PubChem CID 130735161) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-(2,3-dimethylcyclobutyl)-4-methylthiophen-3-amine.
| Compound Name | N-(2,3-dimethylcyclobutyl)-4-methylthiophen-3-amine |
|---|---|
| PubChem CID | 130735161 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-(2,3-dimethylcyclobutyl)-4-methylthiophen-3-amine |
| SMILES | Cc1cscc1NC1CC(C)C1C |
| InChI | InChI=1S/C11H17NS/c1-7-4-10(9(7)3)12-11-6-13-5-8(11)2/h5-7,9-10,12H,4H2,1-3H3 |
| InChIKey | ONFLHZASQMIABM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |