C11H17N3 — CID 130948670
2-N-(2,3-dimethylcyclobutyl)pyridine-2,4-diamine (PubChem CID 130948670) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-N-(2,3-dimethylcyclobutyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(2,3-dimethylcyclobutyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 130948670 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-N-(2,3-dimethylcyclobutyl)pyridine-2,4-diamine |
| SMILES | CC1CC(Nc2cc(N)ccn2)C1C |
| InChI | InChI=1S/C11H17N3/c1-7-5-10(8(7)2)14-11-6-9(12)3-4-13-11/h3-4,6-8,10H,5H2,1-2H3,(H3,12,13,14) |
| InChIKey | NQPXNXPNBMIUIJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |