C8H12N4 — CID 131014799
3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine (PubChem CID 131014799) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine.
| Compound Name | 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 131014799 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine |
| SMILES | C[C@@H]1C[C@H]1Nc1nccnc1N |
| InChI | InChI=1S/C8H12N4/c1-5-4-6(5)12-8-7(9)10-2-3-11-8/h2-3,5-6H,4H2,1H3,(H2,9,10)(H,11,12)/t5-,6-/m1/s1 |
| InChIKey | HTXWZXLMSUAFMN-PHDIDXHHSA-N |
| XLogP | 0.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |