About 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine
3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine (PubChem CID 131014799) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine |
| PubChem CID | 131014799 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine |
| SMILES | C[C@@H]1C[C@H]1Nc1nccnc1N |
| InChI | InChI=1S/C8H12N4/c1-5-4-6(5)12-8-7(9)10-2-3-11-8/h2-3,5-6H,4H2,1H3,(H2,9,10)(H,11,12)/t5-,6-/m1/s1 |
| InChIKey | HTXWZXLMSUAFMN-PHDIDXHHSA-N |
| XLogP | 0.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine?
The IUPAC name of 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine (CID 131014799) is 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine.
What is the SMILES notation for 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine?
The canonical SMILES for 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine is C[C@@H]1C[C@H]1Nc1nccnc1N.
What is the InChIKey of 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine?
The InChIKey is HTXWZXLMSUAFMN-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H12N4/c1-5-4-6(5)12-8-7(9)10-2-3-11-8/h2-3,5-6H,4H2,1H3,(H2,9,10)(H,11,12)/t5-,6-/m1/s1.
What are the key properties of 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine?
3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine has a molecular weight of 164.21 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[(1R,2R)-2-methylcyclopropyl]pyrazine-2,3-diamine is sourced from PubChem (CID 131014799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).