C11H18N4 — CID 103883799
3-N-(3,3-dimethylcyclopentyl)pyrazine-2,3-diamine (PubChem CID 103883799) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-N-(3,3-dimethylcyclopentyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(3,3-dimethylcyclopentyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 103883799 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 3-N-(3,3-dimethylcyclopentyl)pyrazine-2,3-diamine |
| SMILES | CC1(C)CCC(Nc2nccnc2N)C1 |
| InChI | InChI=1S/C11H18N4/c1-11(2)4-3-8(7-11)15-10-9(12)13-5-6-14-10/h5-6,8H,3-4,7H2,1-2H3,(H2,12,13)(H,14,15) |
| InChIKey | NWENFNNWEVQHIR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |