C13H21N3 — CID 114543290
2-N-(3,3-dimethylcyclopentyl)-3-methylpyridine-2,5-diamine (PubChem CID 114543290) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-N-(3,3-dimethylcyclopentyl)-3-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(3,3-dimethylcyclopentyl)-3-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 114543290 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-N-(3,3-dimethylcyclopentyl)-3-methylpyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C13H21N3/c1-9-6-10(14)8-15-12(9)16-11-4-5-13(2,3)7-11/h6,8,11H,4-5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | UJJYUSDUECYFGB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |