C12H19ClN4 — CID 106812467
5-chloro-4-N-(3,3-dimethylcyclohexyl)pyrimidine-4,6-diamine (PubChem CID 106812467) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 5-chloro-4-N-(3,3-dimethylcyclohexyl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(3,3-dimethylcyclohexyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106812467 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-chloro-4-N-(3,3-dimethylcyclohexyl)pyrimidine-4,6-diamine |
| SMILES | CC1(C)CCCC(Nc2ncnc(N)c2Cl)C1 |
| InChI | InChI=1S/C12H19ClN4/c1-12(2)5-3-4-8(6-12)17-11-9(13)10(14)15-7-16-11/h7-8H,3-6H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | GASFUHBKMQTMAW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |