C12H20N4 — CID 103753764
3-N-(2,2-dimethylcyclohexyl)pyrazine-2,3-diamine (PubChem CID 103753764) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-N-(2,2-dimethylcyclohexyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(2,2-dimethylcyclohexyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 103753764 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 3-N-(2,2-dimethylcyclohexyl)pyrazine-2,3-diamine |
| SMILES | CC1(C)CCCCC1Nc1nccnc1N |
| InChI | InChI=1S/C12H20N4/c1-12(2)6-4-3-5-9(12)16-11-10(13)14-7-8-15-11/h7-9H,3-6H2,1-2H3,(H2,13,14)(H,15,16) |
| InChIKey | FKBJSLACIWCYNN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |