C14H22N2O2S — CID 114598974
N-(2,2-dimethylcyclohexyl)-3-methylsulfonylpyridin-2-amine (PubChem CID 114598974) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-(2,2-dimethylcyclohexyl)-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 114598974 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-3-methylsulfonylpyridin-2-amine |
| SMILES | CC1(C)CCCCC1Nc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O2S/c1-14(2)9-5-4-8-12(14)16-13-11(19(3,17)18)7-6-10-15-13/h6-7,10,12H,4-5,8-9H2,1-3H3,(H,15,16) |
| InChIKey | CUZPSCLQYWVSKK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |