C13H20N2O2S2 — CID 106544504
N-(3-methylsulfanylcyclohexyl)-3-methylsulfonylpyridin-2-amine (PubChem CID 106544504) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclohexyl)-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-(3-methylsulfanylcyclohexyl)-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 106544504 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(3-methylsulfanylcyclohexyl)-3-methylsulfonylpyridin-2-amine |
| SMILES | CSC1CCCC(Nc2ncccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-18-11-6-3-5-10(9-11)15-13-12(19(2,16)17)7-4-8-14-13/h4,7-8,10-11H,3,5-6,9H2,1-2H3,(H,14,15) |
| InChIKey | GBTFNUAUIDXROG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |