C12H16N2O2S — CID 114598944
N-cyclohex-3-en-1-yl-3-methylsulfonylpyridin-2-amine (PubChem CID 114598944) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-cyclohex-3-en-1-yl-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 114598944 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-cyclohex-3-en-1-yl-3-methylsulfonylpyridin-2-amine |
| SMILES | CS(=O)(=O)c1cccnc1NC1CC=CCC1 |
| InChI | InChI=1S/C12H16N2O2S/c1-17(15,16)11-8-5-9-13-12(11)14-10-6-3-2-4-7-10/h2-3,5,8-10H,4,6-7H2,1H3,(H,13,14) |
| InChIKey | ZRLIHICNERTZNX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|