C13H14N4 — CID 113228947
3-N-(2-phenylcyclopropyl)pyrazine-2,3-diamine (PubChem CID 113228947) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-N-(2-phenylcyclopropyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(2-phenylcyclopropyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 113228947 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-N-(2-phenylcyclopropyl)pyrazine-2,3-diamine |
| SMILES | Nc1nccnc1NC1CC1c1ccccc1 |
| InChI | InChI=1S/C13H14N4/c14-12-13(16-7-6-15-12)17-11-8-10(11)9-4-2-1-3-5-9/h1-7,10-11H,8H2,(H2,14,15)(H,16,17) |
| InChIKey | MIYVNRJNPBOONW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |