C9H10N4 — CID 43598882
2-[(2-aminocyclopropyl)amino]pyridine-4-carbonitrile (PubChem CID 43598882) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-[(2-aminocyclopropyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-[(2-aminocyclopropyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 43598882 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-[(2-aminocyclopropyl)amino]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC2CC2N)c1 |
| InChI | InChI=1S/C9H10N4/c10-5-6-1-2-12-9(3-6)13-8-4-7(8)11/h1-3,7-8H,4,11H2,(H,12,13) |
| InChIKey | HEWDWVFCBQUHOC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |