C24H18N6 — CID 25124014
2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile (PubChem CID 25124014) has the molecular formula C24H18N6 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile.
| Compound Name | 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 25124014 |
| Molecular Formula | C24H18N6 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(C2CC(c3cc(C#N)ccn3)CC(c3cc(C#N)ccn3)C2)c1 |
| InChI | InChI=1S/C24H18N6/c25-13-16-1-4-28-22(7-16)19-10-20(23-8-17(14-26)2-5-29-23)12-21(11-19)24-9-18(15-27)3-6-30-24/h1-9,19-21H,10-12H2 |
| InChIKey | SGEAXVIZFUBXFK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |