C24H28N6O6S — CID 73132345
4-methyl-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide (PubChem CID 73132345) has the molecular formula C24H28N6O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is 4-methyl-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 73132345 |
| Molecular Formula | C24H28N6O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 4-methyl-N-[6-[5-(3-morpholin-4-ylphenoxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2COC3C2OCC3n2nnnc2Oc2cccc(N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C24H28N6O6S/c1-16-5-7-19(8-6-16)37(31,32)26-20-14-34-23-21(15-35-22(20)23)30-24(25-27-28-30)36-18-4-2-3-17(13-18)29-9-11-33-12-10-29/h2-8,13,20-23,26H,9-12,14-15H2,1H3 |
| InChIKey | MFAIZJKZUFTBAL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |