C15H20N2O6S — CID 162847225
2-[[(3R,3aR,6R,6aR)-3-[(4-methylphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide (PubChem CID 162847225) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aR)-3-[(4-methylphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide.
| Compound Name | 2-[[(3R,3aR,6R,6aR)-3-[(4-methylphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 162847225 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aR)-3-[(4-methylphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CO[C@@H]3[C@@H]2OC[C@H]3OCC(N)=O)cc1 |
| InChI | InChI=1S/C15H20N2O6S/c1-9-2-4-10(5-3-9)24(19,20)17-11-6-22-15-12(7-23-14(11)15)21-8-13(16)18/h2-5,11-12,14-15,17H,6-8H2,1H3,(H2,16,18)/t11-,12-,14-,15+/m1/s1 |
| InChIKey | MOQCSOJSEYUUCT-GBOPCIDUSA-N |
| XLogP | -0.69 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |