C17H24N4O4 — CID 162807402
2-[[(3R,3aR,6R,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide (PubChem CID 162807402) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide.
| Compound Name | 2-[[(3R,3aR,6R,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 162807402 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aR)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
| SMILES | NC(=O)CO[C@@H]1CO[C@H]2[C@H]1OC[C@H]2Nc1nccc(C2CCCC2)n1 |
| InChI | InChI=1S/C17H24N4O4/c18-14(22)9-23-13-8-25-15-12(7-24-16(13)15)21-17-19-6-5-11(20-17)10-3-1-2-4-10/h5-6,10,12-13,15-16H,1-4,7-9H2,(H2,18,22)(H,19,20,21)/t12-,13-,15-,16+/m1/s1 |
| InChIKey | JZRBLYHBEWAGIK-XOUADPBQSA-N |
| XLogP | 0.58 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |