C23H28N4O4 — CID 163124923
[(3S,3aS,6S,6aS)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate (PubChem CID 163124923) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 163124923 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(4-cyclopentylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2Nc1nccc(C2CCCC2)n1 |
| InChI | InChI=1S/C23H28N4O4/c28-23(25-12-15-6-2-1-3-7-15)31-19-14-30-20-18(13-29-21(19)20)27-22-24-11-10-17(26-22)16-8-4-5-9-16/h1-3,6-7,10-11,16,18-21H,4-5,8-9,12-14H2,(H,25,28)(H,24,26,27)/t18-,19-,20-,21+/m0/s1 |
| InChIKey | CXSZPSHIEPXFDS-XSDIEEQYSA-N |
| XLogP | 3.01 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |