C25H27N5O4 — CID 73149102
1-benzyl-3-[3-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea (PubChem CID 73149102) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 1-benzyl-3-[3-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea.
| Compound Name | 1-benzyl-3-[3-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
|---|---|
| PubChem CID | 73149102 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-benzyl-3-[3-[[4-(2-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
| SMILES | COc1ccccc1-c1ccnc(NC2COC3C(NC(=O)NCc4ccccc4)COC23)n1 |
| InChI | InChI=1S/C25H27N5O4/c1-32-21-10-6-5-9-17(21)18-11-12-26-24(28-18)29-19-14-33-23-20(15-34-22(19)23)30-25(31)27-13-16-7-3-2-4-8-16/h2-12,19-20,22-23H,13-15H2,1H3,(H,26,28,29)(H2,27,30,31) |
| InChIKey | APVZJRAUCBOBHE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |